C20H32N2O7S2 — CID 55598179
N-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)-N-(3-morpholin-4-ylpropyl)benzenesulfonamide (PubChem CID 55598179) has the molecular formula C20H32N2O7S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)-N-(3-morpholin-4-ylpropyl)benzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 55598179 |
| Molecular Formula | C20H32N2O7S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-4-(2-methoxyethoxy)-N-(3-morpholin-4-ylpropyl)benzenesulfonamide |
| SMILES | COCCOc1ccc(S(=O)(=O)N(CCCN2CCOCC2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C20H32N2O7S2/c1-27-14-15-29-19-3-5-20(6-4-19)31(25,26)22(18-7-16-30(23,24)17-18)9-2-8-21-10-12-28-13-11-21/h3-6,18H,2,7-17H2,1H3 |
| InChIKey | YKOMZTCTPPVKCB-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|