C17H25N3O7S2 — CID 55384160
N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)-2-nitrobenzenesulfonamide (PubChem CID 55384160) has the molecular formula C17H25N3O7S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)-2-nitrobenzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55384160 |
| Molecular Formula | C17H25N3O7S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N(CCCN1CCOCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H25N3O7S2/c21-20(22)16-4-1-2-5-17(16)29(25,26)19(15-6-13-28(23,24)14-15)8-3-7-18-9-11-27-12-10-18/h1-2,4-5,15H,3,6-14H2 |
| InChIKey | INBAVAVNNHEQAN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 127.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|