C19H28N2O7S2 — CID 55516389
methyl 3-[(1,1-dioxothiolan-3-yl)-(3-morpholin-4-ylpropyl)sulfamoyl]benzoate (PubChem CID 55516389) has the molecular formula C19H28N2O7S2 and a molecular weight of 460.57 g/mol. Its IUPAC name is methyl 3-[(1,1-dioxothiolan-3-yl)-(3-morpholin-4-ylpropyl)sulfamoyl]benzoate.
| Compound Name | methyl 3-[(1,1-dioxothiolan-3-yl)-(3-morpholin-4-ylpropyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 55516389 |
| Molecular Formula | C19H28N2O7S2 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | methyl 3-[(1,1-dioxothiolan-3-yl)-(3-morpholin-4-ylpropyl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)N(CCCN2CCOCC2)C2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C19H28N2O7S2/c1-27-19(22)16-4-2-5-18(14-16)30(25,26)21(17-6-13-29(23,24)15-17)8-3-7-20-9-11-28-12-10-20/h2,4-5,14,17H,3,6-13,15H2,1H3 |
| InChIKey | OKSUMBPSFDUWBJ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |