C19H28N2O6S — CID 90607533
methyl 4-[2-morpholin-4-ylethyl(oxan-4-yl)sulfamoyl]benzoate (PubChem CID 90607533) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is methyl 4-[2-morpholin-4-ylethyl(oxan-4-yl)sulfamoyl]benzoate.
| Compound Name | methyl 4-[2-morpholin-4-ylethyl(oxan-4-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 90607533 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | methyl 4-[2-morpholin-4-ylethyl(oxan-4-yl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(CCN2CCOCC2)C2CCOCC2)cc1 |
| InChI | InChI=1S/C19H28N2O6S/c1-25-19(22)16-2-4-18(5-3-16)28(23,24)21(17-6-12-26-13-7-17)9-8-20-10-14-27-15-11-20/h2-5,17H,6-15H2,1H3 |
| InChIKey | KFHDKWDHMCPKSD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |