C25H32N2O5S — CID 1169072
methyl 4-[cyclohexyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfamoyl]benzoate (PubChem CID 1169072) has the molecular formula C25H32N2O5S and a molecular weight of 472.61 g/mol. Its IUPAC name is methyl 4-[cyclohexyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfamoyl]benzoate.
| Compound Name | methyl 4-[cyclohexyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 1169072 |
| Molecular Formula | C25H32N2O5S |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | methyl 4-[cyclohexyl-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N(CC(=O)Nc2c(C)cc(C)cc2C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H32N2O5S/c1-17-14-18(2)24(19(3)15-17)26-23(28)16-27(21-8-6-5-7-9-21)33(30,31)22-12-10-20(11-13-22)25(29)32-4/h10-15,21H,5-9,16H2,1-4H3,(H,26,28) |
| InChIKey | VNUAZORYPIMOBV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |