C13H14N2O6S2 — CID 55913300
N-(1,1-dioxothiolan-3-yl)-2-nitro-N-prop-2-ynylbenzenesulfonamide (PubChem CID 55913300) has the molecular formula C13H14N2O6S2 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-nitro-N-prop-2-ynylbenzenesulfonamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-nitro-N-prop-2-ynylbenzenesulfonamide |
|---|---|
| PubChem CID | 55913300 |
| Molecular Formula | C13H14N2O6S2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-nitro-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(C1CCS(=O)(=O)C1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14N2O6S2/c1-2-8-14(11-7-9-22(18,19)10-11)23(20,21)13-6-4-3-5-12(13)15(16)17/h1,3-6,11H,7-10H2 |
| InChIKey | JMYWOQMBPMGKJR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|