C22H27N3O4S — CID 56512454
4-[[ethyl-[4-(prop-2-enylsulfamoyl)benzoyl]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 56512454) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is 4-[[ethyl-[4-(prop-2-enylsulfamoyl)benzoyl]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[ethyl-[4-(prop-2-enylsulfamoyl)benzoyl]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 56512454 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 4-[[ethyl-[4-(prop-2-enylsulfamoyl)benzoyl]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)N(CC)Cc2ccc(C(=O)N(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H27N3O4S/c1-5-15-23-30(28,29)20-13-11-19(12-14-20)22(27)25(6-2)16-17-7-9-18(10-8-17)21(26)24(3)4/h5,7-14,23H,1,6,15-16H2,2-4H3 |
| InChIKey | FXCFXMPIAZHIJS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|