C19H25NO4S2 — CID 124728851
N-[(2S)-2-benzyl-3-methylbutyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 124728851) has the molecular formula C19H25NO4S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[(2S)-2-benzyl-3-methylbutyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[(2S)-2-benzyl-3-methylbutyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 124728851 |
| Molecular Formula | C19H25NO4S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-[(2S)-2-benzyl-3-methylbutyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | CC(C)[C@@H](CNS(=O)(=O)c1ccc(S(C)(=O)=O)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO4S2/c1-15(2)17(13-16-7-5-4-6-8-16)14-20-26(23,24)19-11-9-18(10-12-19)25(3,21)22/h4-12,15,17,20H,13-14H2,1-3H3/t17-/m1/s1 |
| InChIKey | FLWJJAQKJOWVJK-QGZVFWFLSA-N |
| XLogP | 2.88 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |