C9H10N2O4S — CID 114959003
(E)-3-[3-(sulfamoylamino)phenyl]prop-2-enoic acid (PubChem CID 114959003) has the molecular formula C9H10N2O4S and a molecular weight of 242.26 g/mol. Its IUPAC name is (E)-3-[3-(sulfamoylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(sulfamoylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114959003 |
| Molecular Formula | C9H10N2O4S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | (E)-3-[3-(sulfamoylamino)phenyl]prop-2-enoic acid |
| SMILES | NS(=O)(=O)Nc1cccc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C9H10N2O4S/c10-16(14,15)11-8-3-1-2-7(6-8)4-5-9(12)13/h1-6,11H,(H,12,13)(H2,10,14,15)/b5-4+ |
| InChIKey | XHJAEAIKVGDYHR-SNAWJCMRSA-N |
| XLogP | 0.40 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|