C11H13NO3 — CID 143268431
(E)-3-[3-(2-hydroxyethylamino)phenyl]prop-2-enoic acid (PubChem CID 143268431) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (E)-3-[3-(2-hydroxyethylamino)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(2-hydroxyethylamino)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 143268431 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (E)-3-[3-(2-hydroxyethylamino)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(NCCO)c1 |
| InChI | InChI=1S/C11H13NO3/c13-7-6-12-10-3-1-2-9(8-10)4-5-11(14)15/h1-5,8,12-13H,6-7H2,(H,14,15)/b5-4+ |
| InChIKey | IPYBYEJQPFGUBG-SNAWJCMRSA-N |
| XLogP | 1.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|