C25H20FNO6S — CID 4519876
(7,8-dimethyl-2-oxochromen-4-yl)methyl 3-[(4-fluorophenyl)sulfamoyl]benzoate (PubChem CID 4519876) has the molecular formula C25H20FNO6S and a molecular weight of 481.50 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-[(4-fluorophenyl)sulfamoyl]benzoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-[(4-fluorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 4519876 |
| Molecular Formula | C25H20FNO6S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-[(4-fluorophenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc2c(COC(=O)c3cccc(S(=O)(=O)Nc4ccc(F)cc4)c3)cc(=O)oc2c1C |
| InChI | InChI=1S/C25H20FNO6S/c1-15-6-11-22-18(13-23(28)33-24(22)16(15)2)14-32-25(29)17-4-3-5-21(12-17)34(30,31)27-20-9-7-19(26)8-10-20/h3-13,27H,14H2,1-2H3 |
| InChIKey | INCZUCUIEZGZOG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|