C23H24FNO6S — CID 30800330
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(4-fluorophenyl)sulfonyl-methylamino]butanoate (PubChem CID 30800330) has the molecular formula C23H24FNO6S and a molecular weight of 461.51 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(4-fluorophenyl)sulfonyl-methylamino]butanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(4-fluorophenyl)sulfonyl-methylamino]butanoate |
|---|---|
| PubChem CID | 30800330 |
| Molecular Formula | C23H24FNO6S |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-[(4-fluorophenyl)sulfonyl-methylamino]butanoate |
| SMILES | Cc1ccc2c(COC(=O)CCCN(C)S(=O)(=O)c3ccc(F)cc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C23H24FNO6S/c1-15-6-11-20-17(13-22(27)31-23(20)16(15)2)14-30-21(26)5-4-12-25(3)32(28,29)19-9-7-18(24)8-10-19/h6-11,13H,4-5,12,14H2,1-3H3 |
| InChIKey | CPGVZTLEUGVFFG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|