C24H23NO4 — CID 5036747
(7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(1H-indol-3-yl)butanoate (PubChem CID 5036747) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(1H-indol-3-yl)butanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(1H-indol-3-yl)butanoate |
|---|---|
| PubChem CID | 5036747 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 4-(1H-indol-3-yl)butanoate |
| SMILES | Cc1ccc2c(COC(=O)CCCc3c[nH]c4ccccc34)cc(=O)oc2c1C |
| InChI | InChI=1S/C24H23NO4/c1-15-10-11-20-18(12-23(27)29-24(20)16(15)2)14-28-22(26)9-5-6-17-13-25-21-8-4-3-7-19(17)21/h3-4,7-8,10-13,25H,5-6,9,14H2,1-2H3 |
| InChIKey | ZOXQYWAYHWKQEO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|