C25H24N2O5 — CID 55325826
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate (PubChem CID 55325826) has the molecular formula C25H24N2O5 and a molecular weight of 432.48 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 55325826 |
| Molecular Formula | C25H24N2O5 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-acetamido-3-(1H-indol-3-yl)propanoate |
| SMILES | CC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)OCc1cc(=O)oc2c(C)c(C)ccc12 |
| InChI | InChI=1S/C25H24N2O5/c1-14-8-9-20-18(11-23(29)32-24(20)15(14)2)13-31-25(30)22(27-16(3)28)10-17-12-26-21-7-5-4-6-19(17)21/h4-9,11-12,22,26H,10,13H2,1-3H3,(H,27,28) |
| InChIKey | QVHGOUURUGCVRU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|