C21H21NO6S — CID 55928648
(7,8-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-(benzenesulfonamido)propanoate (PubChem CID 55928648) has the molecular formula C21H21NO6S and a molecular weight of 415.47 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-(benzenesulfonamido)propanoate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-(benzenesulfonamido)propanoate |
|---|---|
| PubChem CID | 55928648 |
| Molecular Formula | C21H21NO6S |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl (2S)-2-(benzenesulfonamido)propanoate |
| SMILES | Cc1ccc2c(COC(=O)[C@H](C)NS(=O)(=O)c3ccccc3)cc(=O)oc2c1C |
| InChI | InChI=1S/C21H21NO6S/c1-13-9-10-18-16(11-19(23)28-20(18)14(13)2)12-27-21(24)15(3)22-29(25,26)17-7-5-4-6-8-17/h4-11,15,22H,12H2,1-3H3/t15-/m0/s1 |
| InChIKey | PYFVHNAYYDYNOT-HNNXBMFYSA-N |
| XLogP | 2.82 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|