C13H9Br3O2 — CID 132934312
2,4-dibromo-1-(3-bromo-5-methoxyphenoxy)benzene (PubChem CID 132934312) has the molecular formula C13H9Br3O2 and a molecular weight of 436.93 g/mol. Its IUPAC name is 2,4-dibromo-1-(3-bromo-5-methoxyphenoxy)benzene.
| Compound Name | 2,4-dibromo-1-(3-bromo-5-methoxyphenoxy)benzene |
|---|---|
| PubChem CID | 132934312 |
| Molecular Formula | C13H9Br3O2 |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 433.82 |
| IUPAC Name | 2,4-dibromo-1-(3-bromo-5-methoxyphenoxy)benzene |
| SMILES | COc1cc(Br)cc(Oc2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C13H9Br3O2/c1-17-10-4-9(15)5-11(7-10)18-13-3-2-8(14)6-12(13)16/h2-7H,1H3 |
| InChIKey | UIDIFUYLKDBTHY-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |