C15H14BrClO3 — CID 20631724
1-[4-bromo-2-(chloromethyl)phenoxy]-3,5-dimethoxybenzene (PubChem CID 20631724) has the molecular formula C15H14BrClO3 and a molecular weight of 357.63 g/mol. Its IUPAC name is 1-[4-bromo-2-(chloromethyl)phenoxy]-3,5-dimethoxybenzene.
| Compound Name | 1-[4-bromo-2-(chloromethyl)phenoxy]-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 20631724 |
| Molecular Formula | C15H14BrClO3 |
| Molecular Weight | 357.63 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 1-[4-bromo-2-(chloromethyl)phenoxy]-3,5-dimethoxybenzene |
| SMILES | COc1cc(OC)cc(Oc2ccc(Br)cc2CCl)c1 |
| InChI | InChI=1S/C15H14BrClO3/c1-18-12-6-13(19-2)8-14(7-12)20-15-4-3-11(16)5-10(15)9-17/h3-8H,9H2,1-2H3 |
| InChIKey | FSXVSZBKWGSGCD-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|