C15H13Br2ClO2 — CID 59330882
2,4-dibromo-1-[3-(4-chlorophenoxy)propoxy]benzene (PubChem CID 59330882) has the molecular formula C15H13Br2ClO2 and a molecular weight of 420.53 g/mol. Its IUPAC name is 2,4-dibromo-1-[3-(4-chlorophenoxy)propoxy]benzene.
| Compound Name | 2,4-dibromo-1-[3-(4-chlorophenoxy)propoxy]benzene |
|---|---|
| PubChem CID | 59330882 |
| Molecular Formula | C15H13Br2ClO2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 417.90 |
| IUPAC Name | 2,4-dibromo-1-[3-(4-chlorophenoxy)propoxy]benzene |
| SMILES | Clc1ccc(OCCCOc2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C15H13Br2ClO2/c16-11-2-7-15(14(17)10-11)20-9-1-8-19-13-5-3-12(18)4-6-13/h2-7,10H,1,8-9H2 |
| InChIKey | HRHIEUXMOHSLHA-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|