C14H21BrFNO — CID 62599789
N-[2-(4-bromo-2-fluorophenoxy)ethyl]-3,3-dimethylbutan-1-amine (PubChem CID 62599789) has the molecular formula C14H21BrFNO and a molecular weight of 318.23 g/mol. Its IUPAC name is N-[2-(4-bromo-2-fluorophenoxy)ethyl]-3,3-dimethylbutan-1-amine.
| Compound Name | N-[2-(4-bromo-2-fluorophenoxy)ethyl]-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 62599789 |
| Molecular Formula | C14H21BrFNO |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | N-[2-(4-bromo-2-fluorophenoxy)ethyl]-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(C)CCNCCOc1ccc(Br)cc1F |
| InChI | InChI=1S/C14H21BrFNO/c1-14(2,3)6-7-17-8-9-18-13-5-4-11(15)10-12(13)16/h4-5,10,17H,6-9H2,1-3H3 |
| InChIKey | HTQOORLTMSBYCU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|