C9H7Cl2NOS — CID 82086707
1,2-dichloro-3-(2-isothiocyanatoethoxy)benzene (PubChem CID 82086707) has the molecular formula C9H7Cl2NOS and a molecular weight of 248.13 g/mol. Its IUPAC name is 1,2-dichloro-3-(2-isothiocyanatoethoxy)benzene.
| Compound Name | 1,2-dichloro-3-(2-isothiocyanatoethoxy)benzene |
|---|---|
| PubChem CID | 82086707 |
| Molecular Formula | C9H7Cl2NOS |
| Molecular Weight | 248.13 g/mol |
| Exact Mass | 246.96 |
| IUPAC Name | 1,2-dichloro-3-(2-isothiocyanatoethoxy)benzene |
| SMILES | S=C=NCCOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C9H7Cl2NOS/c10-7-2-1-3-8(9(7)11)13-5-4-12-6-14/h1-3H,4-5H2 |
| InChIKey | RRAGFGCNXYQATQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.13 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|