C16H16Cl2O3 — CID 2289149
1,2-dichloro-3-[2-(2-methoxy-4-methylphenoxy)ethoxy]benzene (PubChem CID 2289149) has the molecular formula C16H16Cl2O3 and a molecular weight of 327.21 g/mol. Its IUPAC name is 1,2-dichloro-3-[2-(2-methoxy-4-methylphenoxy)ethoxy]benzene.
| Compound Name | 1,2-dichloro-3-[2-(2-methoxy-4-methylphenoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 2289149 |
| Molecular Formula | C16H16Cl2O3 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1,2-dichloro-3-[2-(2-methoxy-4-methylphenoxy)ethoxy]benzene |
| SMILES | COc1cc(C)ccc1OCCOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H16Cl2O3/c1-11-6-7-13(15(10-11)19-2)20-8-9-21-14-5-3-4-12(17)16(14)18/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | BYMQVQJKEMACOI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|