C12H18Cl3NO — CID 134107311
2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride (PubChem CID 134107311) has the molecular formula C12H18Cl3NO and a molecular weight of 298.64 g/mol. Its IUPAC name is 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride.
| Compound Name | 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride |
|---|---|
| PubChem CID | 134107311 |
| Molecular Formula | C12H18Cl3NO |
| Molecular Weight | 298.64 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride |
| SMILES | CC[NH+](CC)CCOc1cccc(Cl)c1Cl.[Cl-] |
| InChI | InChI=1S/C12H17Cl2NO.ClH/c1-3-15(4-2)8-9-16-11-7-5-6-10(13)12(11)14;/h5-7H,3-4,8-9H2,1-2H3;1H |
| InChIKey | PKRUPEBEGQXPQI-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.64 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |