2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride

C12H18Cl3NO — CID 134107311

IUPAC2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride
SMILESCC[NH+](CC)CCOc1cccc(Cl)c1Cl.[Cl-]
InChIInChI=1S/C12H17Cl2NO.ClH/c1-3-15(4-2)8-9-16-11-7-5-6-10(13)12(11)14;/h5-7H,3-4,8-9H2,1-2H3;1H
InChIKeyPKRUPEBEGQXPQI-UHFFFAOYSA-N
MW298.64 g/mol
LogP-0.70
Rot. Bonds6

About 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride

2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride (PubChem CID 134107311) has the molecular formula C12H18Cl3NO and a molecular weight of 298.64 g/mol. Its IUPAC name is 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride.

Molecular Properties

Compound Name2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride
PubChem CID134107311
Molecular FormulaC12H18Cl3NO
Molecular Weight298.64 g/mol
Exact Mass297.05
IUPAC Name2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride
SMILESCC[NH+](CC)CCOc1cccc(Cl)c1Cl.[Cl-]
InChIInChI=1S/C12H17Cl2NO.ClH/c1-3-15(4-2)8-9-16-11-7-5-6-10(13)12(11)14;/h5-7H,3-4,8-9H2,1-2H3;1H
InChIKeyPKRUPEBEGQXPQI-UHFFFAOYSA-N
XLogP-0.70
TPSA13.67 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.64
LogP ≤ 5-0.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride?
The IUPAC name of 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride (CID 134107311) is 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride.
What is the SMILES notation for 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride?
The canonical SMILES for 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride is CC[NH+](CC)CCOc1cccc(Cl)c1Cl.[Cl-].
What is the InChIKey of 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride?
The InChIKey is PKRUPEBEGQXPQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Cl2NO.ClH/c1-3-15(4-2)8-9-16-11-7-5-6-10(13)12(11)14;/h5-7H,3-4,8-9H2,1-2H3;1H.
What are the key properties of 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride?
2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride has a molecular weight of 298.64 g/mol, XLogP of -0.70, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dichlorophenoxy)ethyl-diethylazanium chloride is sourced from PubChem (CID 134107311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).