C22H26N2O3 — CID 20990071
2-cyano-N-[2-[4-[2-(2,3,6-trimethylphenoxy)ethoxy]phenyl]ethyl]acetamide (PubChem CID 20990071) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-cyano-N-[2-[4-[2-(2,3,6-trimethylphenoxy)ethoxy]phenyl]ethyl]acetamide.
| Compound Name | 2-cyano-N-[2-[4-[2-(2,3,6-trimethylphenoxy)ethoxy]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 20990071 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-cyano-N-[2-[4-[2-(2,3,6-trimethylphenoxy)ethoxy]phenyl]ethyl]acetamide |
| SMILES | Cc1ccc(C)c(OCCOc2ccc(CCNC(=O)CC#N)cc2)c1C |
| InChI | InChI=1S/C22H26N2O3/c1-16-4-5-17(2)22(18(16)3)27-15-14-26-20-8-6-19(7-9-20)11-13-24-21(25)10-12-23/h4-9H,10-11,13-15H2,1-3H3,(H,24,25) |
| InChIKey | SIKCQECYCIXJPQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|