C21H24N2O3 — CID 22684620
2-cyano-N-[2-[3-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]ethyl]acetamide (PubChem CID 22684620) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-cyano-N-[2-[3-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]ethyl]acetamide.
| Compound Name | 2-cyano-N-[2-[3-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 22684620 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-cyano-N-[2-[3-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]ethyl]acetamide |
| SMILES | Cc1ccc(OCCOc2cccc(CCNC(=O)CC#N)c2)cc1C |
| InChI | InChI=1S/C21H24N2O3/c1-16-6-7-20(14-17(16)2)26-13-12-25-19-5-3-4-18(15-19)9-11-23-21(24)8-10-22/h3-7,14-15H,8-9,11-13H2,1-2H3,(H,23,24) |
| InChIKey | XTTOLEZZMBIMIP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|