C22H26N2O4 — CID 20986864
2-cyano-N-[2-[4-[2-(2,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]ethyl]acetamide (PubChem CID 20986864) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-cyano-N-[2-[4-[2-(2,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]ethyl]acetamide.
| Compound Name | 2-cyano-N-[2-[4-[2-(2,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 20986864 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-cyano-N-[2-[4-[2-(2,5-dimethylphenoxy)ethoxy]-3-methoxyphenyl]ethyl]acetamide |
| SMILES | COc1cc(CCNC(=O)CC#N)ccc1OCCOc1cc(C)ccc1C |
| InChI | InChI=1S/C22H26N2O4/c1-16-4-5-17(2)20(14-16)28-13-12-27-19-7-6-18(15-21(19)26-3)9-11-24-22(25)8-10-23/h4-7,14-15H,8-9,11-13H2,1-3H3,(H,24,25) |
| InChIKey | TZIAAFGRQBXDHB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|