C17H25N3O3 — CID 20987479
2-cyano-N-[2-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]ethyl]acetamide (PubChem CID 20987479) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is 2-cyano-N-[2-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]ethyl]acetamide.
| Compound Name | 2-cyano-N-[2-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 20987479 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2-cyano-N-[2-[4-[3-(dimethylamino)propoxy]-3-methoxyphenyl]ethyl]acetamide |
| SMILES | COc1cc(CCNC(=O)CC#N)ccc1OCCCN(C)C |
| InChI | InChI=1S/C17H25N3O3/c1-20(2)11-4-12-23-15-6-5-14(13-16(15)22-3)8-10-19-17(21)7-9-18/h5-6,13H,4,7-8,10-12H2,1-3H3,(H,19,21) |
| InChIKey | JOYTZTXXEWBARS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|