C15H21N3O3 — CID 28569763
N-(2-cyanoethyl)-2-[2-(3,4-dimethoxyphenyl)ethylamino]acetamide (PubChem CID 28569763) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[2-(3,4-dimethoxyphenyl)ethylamino]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[2-(3,4-dimethoxyphenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 28569763 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-(2-cyanoethyl)-2-[2-(3,4-dimethoxyphenyl)ethylamino]acetamide |
| SMILES | COc1ccc(CCNCC(=O)NCCC#N)cc1OC |
| InChI | InChI=1S/C15H21N3O3/c1-20-13-5-4-12(10-14(13)21-2)6-9-17-11-15(19)18-8-3-7-16/h4-5,10,17H,3,6,8-9,11H2,1-2H3,(H,18,19) |
| InChIKey | SEILLANUAZBYLW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|