C22H26N2O4 — CID 22684082
2-cyano-N-[[4-methoxy-3-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methyl]acetamide (PubChem CID 22684082) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-cyano-N-[[4-methoxy-3-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methyl]acetamide.
| Compound Name | 2-cyano-N-[[4-methoxy-3-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 22684082 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-cyano-N-[[4-methoxy-3-[2-(2,3,5-trimethylphenoxy)ethoxy]phenyl]methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CC#N)cc1OCCOc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C22H26N2O4/c1-15-11-16(2)17(3)20(12-15)27-9-10-28-21-13-18(5-6-19(21)26-4)14-24-22(25)7-8-23/h5-6,11-13H,7,9-10,14H2,1-4H3,(H,24,25) |
| InChIKey | LNVASOAZZKABGB-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|