C20H22N2O3 — CID 20984627
2-cyano-N-[[3-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]methyl]acetamide (PubChem CID 20984627) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-cyano-N-[[3-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]methyl]acetamide.
| Compound Name | 2-cyano-N-[[3-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 20984627 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-cyano-N-[[3-[2-(2,5-dimethylphenoxy)ethoxy]phenyl]methyl]acetamide |
| SMILES | Cc1ccc(C)c(OCCOc2cccc(CNC(=O)CC#N)c2)c1 |
| InChI | InChI=1S/C20H22N2O3/c1-15-6-7-16(2)19(12-15)25-11-10-24-18-5-3-4-17(13-18)14-22-20(23)8-9-21/h3-7,12-13H,8,10-11,14H2,1-2H3,(H,22,23) |
| InChIKey | UNPGATSUWHQRHY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|