C11H12N2O3 — CID 20985064
2-cyano-N-[(3-hydroxy-4-methoxyphenyl)methyl]acetamide (PubChem CID 20985064) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-cyano-N-[(3-hydroxy-4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-cyano-N-[(3-hydroxy-4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 20985064 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-cyano-N-[(3-hydroxy-4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)CC#N)cc1O |
| InChI | InChI=1S/C11H12N2O3/c1-16-10-3-2-8(6-9(10)14)7-13-11(15)4-5-12/h2-3,6,14H,4,7H2,1H3,(H,13,15) |
| InChIKey | KUBMHTNZAKHVGR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 82.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |