C15H10BrF2NO4S — CID 31391920
(2-bromo-4-cyano-6-ethoxyphenyl) 2,6-difluorobenzenesulfonate (PubChem CID 31391920) has the molecular formula C15H10BrF2NO4S and a molecular weight of 418.22 g/mol. Its IUPAC name is (2-bromo-4-cyano-6-ethoxyphenyl) 2,6-difluorobenzenesulfonate.
| Compound Name | (2-bromo-4-cyano-6-ethoxyphenyl) 2,6-difluorobenzenesulfonate |
|---|---|
| PubChem CID | 31391920 |
| Molecular Formula | C15H10BrF2NO4S |
| Molecular Weight | 418.22 g/mol |
| Exact Mass | 416.95 |
| IUPAC Name | (2-bromo-4-cyano-6-ethoxyphenyl) 2,6-difluorobenzenesulfonate |
| SMILES | CCOc1cc(C#N)cc(Br)c1OS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C15H10BrF2NO4S/c1-2-22-13-7-9(8-19)6-10(16)14(13)23-24(20,21)15-11(17)4-3-5-12(15)18/h3-7H,2H2,1H3 |
| InChIKey | PWJQWSOSLDXLNI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.22 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|