About (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate
(4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate (PubChem CID 51169722) has the molecular formula C15H12FNO4S
and a molecular weight of 321.33 g/mol. Its IUPAC name is (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate.
Molecular Properties
| Compound Name | (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate |
| PubChem CID | 51169722 |
| Molecular Formula | C15H12FNO4S |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate |
| SMILES | CCOc1cc(C#N)ccc1OS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C15H12FNO4S/c1-2-20-14-9-11(10-17)7-8-13(14)21-22(18,19)15-6-4-3-5-12(15)16/h3-9H,2H2,1H3 |
| InChIKey | UEMQHFRVFAHJNN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate?
The IUPAC name of (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate (CID 51169722) is (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate.
What is the SMILES notation for (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate?
The canonical SMILES for (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate is CCOc1cc(C#N)ccc1OS(=O)(=O)c1ccccc1F.
What is the InChIKey of (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate?
The InChIKey is UEMQHFRVFAHJNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12FNO4S/c1-2-20-14-9-11(10-17)7-8-13(14)21-22(18,19)15-6-4-3-5-12(15)16/h3-9H,2H2,1H3.
What are the key properties of (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate?
(4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate has a molecular weight of 321.33 g/mol, XLogP of 2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-2-ethoxyphenyl) 2-fluorobenzenesulfonate is sourced from PubChem (CID 51169722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).