(4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate

C20H20ClNO4 — CID 7363374

IUPAC(4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate
SMILESCCCOc1c(Cl)cc(C(=O)OCc2ccc(C#N)cc2)cc1OCC
InChIInChI=1S/C20H20ClNO4/c1-3-9-25-19-17(21)10-16(11-18(19)24-4-2)20(23)26-13-15-7-5-14(12-22)6-8-15/h5-8,10-11H,3-4,9,13H2,1-2H3
InChIKeyKTNRJNAZHYTFLT-UHFFFAOYSA-N
MW373.84 g/mol
LogP4.76
Rot. Bonds8

About (4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate

(4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate (PubChem CID 7363374) has the molecular formula C20H20ClNO4 and a molecular weight of 373.84 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate.

Molecular Properties

Compound Name(4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate
PubChem CID7363374
Molecular FormulaC20H20ClNO4
Molecular Weight373.84 g/mol
Exact Mass373.11
IUPAC Name(4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate
SMILESCCCOc1c(Cl)cc(C(=O)OCc2ccc(C#N)cc2)cc1OCC
InChIInChI=1S/C20H20ClNO4/c1-3-9-25-19-17(21)10-16(11-18(19)24-4-2)20(23)26-13-15-7-5-14(12-22)6-8-15/h5-8,10-11H,3-4,9,13H2,1-2H3
InChIKeyKTNRJNAZHYTFLT-UHFFFAOYSA-N
XLogP4.76
TPSA68.55 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500373.84
LogP ≤ 54.76
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze (4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate?
The IUPAC name of (4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate (CID 7363374) is (4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate.
What is the SMILES notation for (4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate?
The canonical SMILES for (4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate is CCCOc1c(Cl)cc(C(=O)OCc2ccc(C#N)cc2)cc1OCC.
What is the InChIKey of (4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate?
The InChIKey is KTNRJNAZHYTFLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20ClNO4/c1-3-9-25-19-17(21)10-16(11-18(19)24-4-2)20(23)26-13-15-7-5-14(12-22)6-8-15/h5-8,10-11H,3-4,9,13H2,1-2H3.
What are the key properties of (4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate?
(4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate has a molecular weight of 373.84 g/mol, XLogP of 4.76, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyanophenyl)methyl 3-chloro-5-ethoxy-4-propoxybenzoate is sourced from PubChem (CID 7363374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).