C20H28ClNO5 — CID 55310428
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 3-chloro-5-ethoxy-4-propoxybenzoate (PubChem CID 55310428) has the molecular formula C20H28ClNO5 and a molecular weight of 397.90 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 3-chloro-5-ethoxy-4-propoxybenzoate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 3-chloro-5-ethoxy-4-propoxybenzoate |
|---|---|
| PubChem CID | 55310428 |
| Molecular Formula | C20H28ClNO5 |
| Molecular Weight | 397.90 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 3-chloro-5-ethoxy-4-propoxybenzoate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)c1cc(Cl)c(OCCC)c(OCC)c1 |
| InChI | InChI=1S/C20H28ClNO5/c1-6-9-26-19-16(21)10-15(11-17(19)25-8-3)20(24)27-13-18(23)22(7-2)12-14(4)5/h10-11H,4,6-9,12-13H2,1-3,5H3 |
| InChIKey | QPYWBHJGBFYYSY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.90 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|