C16H18Cl3NO4 — CID 55315903
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate (PubChem CID 55315903) has the molecular formula C16H18Cl3NO4 and a molecular weight of 394.68 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
|---|---|
| PubChem CID | 55315903 |
| Molecular Formula | C16H18Cl3NO4 |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-(2,4,5-trichlorophenoxy)acetate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl3NO4/c1-4-20(7-10(2)3)15(21)8-24-16(22)9-23-14-6-12(18)11(17)5-13(14)19/h5-6H,2,4,7-9H2,1,3H3 |
| InChIKey | CRTBUBHQXLBAIO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|