C16H21NO3 — CID 112781553
2-(2-acetylphenoxy)-N-ethyl-N-(2-methylprop-2-enyl)acetamide (PubChem CID 112781553) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 2-(2-acetylphenoxy)-N-ethyl-N-(2-methylprop-2-enyl)acetamide.
| Compound Name | 2-(2-acetylphenoxy)-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 112781553 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 2-(2-acetylphenoxy)-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
| SMILES | C=C(C)CN(CC)C(=O)COc1ccccc1C(C)=O |
| InChI | InChI=1S/C16H21NO3/c1-5-17(10-12(2)3)16(19)11-20-15-9-7-6-8-14(15)13(4)18/h6-9H,2,5,10-11H2,1,3-4H3 |
| InChIKey | APAUMUOFQAEFKJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|