C16H23NO4 — CID 78767254
2-(2,6-dimethoxyphenoxy)-N-ethyl-N-(2-methylprop-2-enyl)acetamide (PubChem CID 78767254) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-(2,6-dimethoxyphenoxy)-N-ethyl-N-(2-methylprop-2-enyl)acetamide.
| Compound Name | 2-(2,6-dimethoxyphenoxy)-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
|---|---|
| PubChem CID | 78767254 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-(2,6-dimethoxyphenoxy)-N-ethyl-N-(2-methylprop-2-enyl)acetamide |
| SMILES | C=C(C)CN(CC)C(=O)COc1c(OC)cccc1OC |
| InChI | InChI=1S/C16H23NO4/c1-6-17(10-12(2)3)15(18)11-21-16-13(19-4)8-7-9-14(16)20-5/h7-9H,2,6,10-11H2,1,3-5H3 |
| InChIKey | CFQMJDFDKYWVCZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|