C12H14O4 — CID 61379741
3-methoxy-2-(2-methylprop-2-enoxy)benzoic acid (PubChem CID 61379741) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-methoxy-2-(2-methylprop-2-enoxy)benzoic acid.
| Compound Name | 3-methoxy-2-(2-methylprop-2-enoxy)benzoic acid |
|---|---|
| PubChem CID | 61379741 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 3-methoxy-2-(2-methylprop-2-enoxy)benzoic acid |
| SMILES | C=C(C)COc1c(OC)cccc1C(=O)O |
| InChI | InChI=1S/C12H14O4/c1-8(2)7-16-11-9(12(13)14)5-4-6-10(11)15-3/h4-6H,1,7H2,2-3H3,(H,13,14) |
| InChIKey | IKLNIKRGMVQVDF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|