C12H12N2O5 — CID 43471761
2-[2-(cyanomethylamino)-2-oxoethoxy]-3-methoxybenzoic acid (PubChem CID 43471761) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is 2-[2-(cyanomethylamino)-2-oxoethoxy]-3-methoxybenzoic acid.
| Compound Name | 2-[2-(cyanomethylamino)-2-oxoethoxy]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 43471761 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 2-[2-(cyanomethylamino)-2-oxoethoxy]-3-methoxybenzoic acid |
| SMILES | COc1cccc(C(=O)O)c1OCC(=O)NCC#N |
| InChI | InChI=1S/C12H12N2O5/c1-18-9-4-2-3-8(12(16)17)11(9)19-7-10(15)14-6-5-13/h2-4H,6-7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | JYSYGAVVUUZJQA-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|