C10H9N3O4 — CID 61380031
3-[2-(cyanomethylamino)-2-oxoethoxy]pyridine-2-carboxylic acid (PubChem CID 61380031) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 3-[2-(cyanomethylamino)-2-oxoethoxy]pyridine-2-carboxylic acid.
| Compound Name | 3-[2-(cyanomethylamino)-2-oxoethoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 61380031 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3-[2-(cyanomethylamino)-2-oxoethoxy]pyridine-2-carboxylic acid |
| SMILES | N#CCNC(=O)COc1cccnc1C(=O)O |
| InChI | InChI=1S/C10H9N3O4/c11-3-5-12-8(14)6-17-7-2-1-4-13-9(7)10(15)16/h1-2,4H,5-6H2,(H,12,14)(H,15,16) |
| InChIKey | BALFLQYMGXURNG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|