C12H10N4O4 — CID 61380261
3-[2-oxo-2-(pyrimidin-2-ylamino)ethoxy]pyridine-2-carboxylic acid (PubChem CID 61380261) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is 3-[2-oxo-2-(pyrimidin-2-ylamino)ethoxy]pyridine-2-carboxylic acid.
| Compound Name | 3-[2-oxo-2-(pyrimidin-2-ylamino)ethoxy]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 61380261 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 3-[2-oxo-2-(pyrimidin-2-ylamino)ethoxy]pyridine-2-carboxylic acid |
| SMILES | O=C(COc1cccnc1C(=O)O)Nc1ncccn1 |
| InChI | InChI=1S/C12H10N4O4/c17-9(16-12-14-5-2-6-15-12)7-20-8-3-1-4-13-10(8)11(18)19/h1-6H,7H2,(H,18,19)(H,14,15,16,17) |
| InChIKey | GOFUZXGRBHXFKN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |