C13H14N2O5 — CID 43516619
N-(cyanomethyl)-2-(4-formyl-2,6-dimethoxyphenoxy)acetamide (PubChem CID 43516619) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(4-formyl-2,6-dimethoxyphenoxy)acetamide.
| Compound Name | N-(cyanomethyl)-2-(4-formyl-2,6-dimethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 43516619 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | N-(cyanomethyl)-2-(4-formyl-2,6-dimethoxyphenoxy)acetamide |
| SMILES | COc1cc(C=O)cc(OC)c1OCC(=O)NCC#N |
| InChI | InChI=1S/C13H14N2O5/c1-18-10-5-9(7-16)6-11(19-2)13(10)20-8-12(17)15-4-3-14/h5-7H,4,8H2,1-2H3,(H,15,17) |
| InChIKey | DXLCZCFSDIQOSQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|