C11H11N3O4 — CID 107076873
2-amino-5-[2-(cyanomethylamino)-2-oxoethoxy]benzoic acid (PubChem CID 107076873) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 2-amino-5-[2-(cyanomethylamino)-2-oxoethoxy]benzoic acid.
| Compound Name | 2-amino-5-[2-(cyanomethylamino)-2-oxoethoxy]benzoic acid |
|---|---|
| PubChem CID | 107076873 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-amino-5-[2-(cyanomethylamino)-2-oxoethoxy]benzoic acid |
| SMILES | N#CCNC(=O)COc1ccc(N)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H11N3O4/c12-3-4-14-10(15)6-18-7-1-2-9(13)8(5-7)11(16)17/h1-2,5H,4,6,13H2,(H,14,15)(H,16,17) |
| InChIKey | YLERQSUYBJAHAO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|