C23H25BrN2O5 — CID 35950064
[2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-[2-(4-bromoanilino)-2-oxoethoxy]benzoate (PubChem CID 35950064) has the molecular formula C23H25BrN2O5 and a molecular weight of 489.37 g/mol. Its IUPAC name is [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-[2-(4-bromoanilino)-2-oxoethoxy]benzoate.
| Compound Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-[2-(4-bromoanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 35950064 |
| Molecular Formula | C23H25BrN2O5 |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | [2-[ethyl(2-methylprop-2-enyl)amino]-2-oxoethyl] 2-[2-(4-bromoanilino)-2-oxoethoxy]benzoate |
| SMILES | C=C(C)CN(CC)C(=O)COC(=O)c1ccccc1OCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H25BrN2O5/c1-4-26(13-16(2)3)22(28)15-31-23(29)19-7-5-6-8-20(19)30-14-21(27)25-18-11-9-17(24)10-12-18/h5-12H,2,4,13-15H2,1,3H3,(H,25,27) |
| InChIKey | CLAYXHBFUGJOLQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|