C17H24N2O5 — CID 9197450
[2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-ethoxybenzoate (PubChem CID 9197450) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is [2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-ethoxybenzoate.
| Compound Name | [2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-ethoxybenzoate |
|---|---|
| PubChem CID | 9197450 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-ethoxybenzoate |
| SMILES | CCNC(=O)CN(CC)C(=O)COC(=O)c1ccccc1OCC |
| InChI | InChI=1S/C17H24N2O5/c1-4-18-15(20)11-19(5-2)16(21)12-24-17(22)13-9-7-8-10-14(13)23-6-3/h7-10H,4-6,11-12H2,1-3H3,(H,18,20) |
| InChIKey | PPABQDBOEUZVLZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |