C16H22N2O4S — CID 8841059
[2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate (PubChem CID 8841059) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is [2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate.
| Compound Name | [2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8841059 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | [2-[ethyl-[2-(ethylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-methylsulfanylbenzoate |
| SMILES | CCNC(=O)CN(CC)C(=O)COC(=O)c1ccccc1SC |
| InChI | InChI=1S/C16H22N2O4S/c1-4-17-14(19)10-18(5-2)15(20)11-22-16(21)12-8-6-7-9-13(12)23-3/h6-9H,4-5,10-11H2,1-3H3,(H,17,19) |
| InChIKey | XIURAZPFAOTQGD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |