C13H14Cl3NO4 — CID 61013284
2-[propyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetic acid (PubChem CID 61013284) has the molecular formula C13H14Cl3NO4 and a molecular weight of 354.62 g/mol. Its IUPAC name is 2-[propyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetic acid.
| Compound Name | 2-[propyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 61013284 |
| Molecular Formula | C13H14Cl3NO4 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 353.00 |
| IUPAC Name | 2-[propyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetic acid |
| SMILES | CCCN(CC(=O)O)C(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H14Cl3NO4/c1-2-3-17(6-13(19)20)12(18)7-21-11-5-9(15)8(14)4-10(11)16/h4-5H,2-3,6-7H2,1H3,(H,19,20) |
| InChIKey | NDHRSCDYGIXMCV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|