C15H18Cl3NO5 — CID 55725983
ethyl 2-[2-methoxyethyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetate (PubChem CID 55725983) has the molecular formula C15H18Cl3NO5 and a molecular weight of 398.67 g/mol. Its IUPAC name is ethyl 2-[2-methoxyethyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetate.
| Compound Name | ethyl 2-[2-methoxyethyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetate |
|---|---|
| PubChem CID | 55725983 |
| Molecular Formula | C15H18Cl3NO5 |
| Molecular Weight | 398.67 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | ethyl 2-[2-methoxyethyl-[2-(2,4,5-trichlorophenoxy)acetyl]amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)COc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H18Cl3NO5/c1-3-23-15(21)8-19(4-5-22-2)14(20)9-24-13-7-11(17)10(16)6-12(13)18/h6-7H,3-5,8-9H2,1-2H3 |
| InChIKey | LNBFOEQBOURFKR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|