C20H20BrNO3S2 — CID 31838012
3-bromo-4-ethoxy-5-methoxy-N,N-bis(thiophen-2-ylmethyl)benzamide (PubChem CID 31838012) has the molecular formula C20H20BrNO3S2 and a molecular weight of 466.42 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-5-methoxy-N,N-bis(thiophen-2-ylmethyl)benzamide.
| Compound Name | 3-bromo-4-ethoxy-5-methoxy-N,N-bis(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 31838012 |
| Molecular Formula | C20H20BrNO3S2 |
| Molecular Weight | 466.42 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | 3-bromo-4-ethoxy-5-methoxy-N,N-bis(thiophen-2-ylmethyl)benzamide |
| SMILES | CCOc1c(Br)cc(C(=O)N(Cc2cccs2)Cc2cccs2)cc1OC |
| InChI | InChI=1S/C20H20BrNO3S2/c1-3-25-19-17(21)10-14(11-18(19)24-2)20(23)22(12-15-6-4-8-26-15)13-16-7-5-9-27-16/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | FIGGVHSFHZKJDA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.42 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |