C21H20FNO4S — CID 17013553
N-(4-fluorophenyl)-3,4,5-trimethoxy-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 17013553) has the molecular formula C21H20FNO4S and a molecular weight of 401.46 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3,4,5-trimethoxy-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | N-(4-fluorophenyl)-3,4,5-trimethoxy-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17013553 |
| Molecular Formula | C21H20FNO4S |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | N-(4-fluorophenyl)-3,4,5-trimethoxy-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | COc1cc(C(=O)N(Cc2cccs2)c2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H20FNO4S/c1-25-18-11-14(12-19(26-2)20(18)27-3)21(24)23(13-17-5-4-10-28-17)16-8-6-15(22)7-9-16/h4-12H,13H2,1-3H3 |
| InChIKey | FTBJCCSOGGEWPT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |